C19H21BrN3O2+ — CID 9039741
(5-bromo-2-methoxyphenyl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-methylazanium (PubChem CID 9039741) has the molecular formula C19H21BrN3O2+ and a molecular weight of 403.30 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-methylazanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 9039741 |
| Molecular Formula | C19H21BrN3O2+ |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[2-[4-(cyanomethyl)anilino]-2-oxoethyl]-methylazanium |
| SMILES | COc1ccc(Br)cc1C[NH+](C)CC(=O)Nc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C19H20BrN3O2/c1-23(12-15-11-16(20)5-8-18(15)25-2)13-19(24)22-17-6-3-14(4-7-17)9-10-21/h3-8,11H,9,12-13H2,1-2H3,(H,22,24)/p+1 |
| InChIKey | MPSRPBZUQXBRKG-UHFFFAOYSA-O |
| XLogP | 2.18 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |