C16H26BrN2O2+ — CID 8794242
(5-bromo-2-methoxyphenyl)methyl-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium (PubChem CID 8794242) has the molecular formula C16H26BrN2O2+ and a molecular weight of 358.30 g/mol. Its IUPAC name is (5-bromo-2-methoxyphenyl)methyl-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium.
| Compound Name | (5-bromo-2-methoxyphenyl)methyl-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
|---|---|
| PubChem CID | 8794242 |
| Molecular Formula | C16H26BrN2O2+ |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (5-bromo-2-methoxyphenyl)methyl-[2-(tert-butylamino)-2-oxoethyl]-ethylazanium |
| SMILES | CC[NH+](CC(=O)NC(C)(C)C)Cc1cc(Br)ccc1OC |
| InChI | InChI=1S/C16H25BrN2O2/c1-6-19(11-15(20)18-16(2,3)4)10-12-9-13(17)7-8-14(12)21-5/h7-9H,6,10-11H2,1-5H3,(H,18,20)/p+1 |
| InChIKey | XFJBLQITKIZQHF-UHFFFAOYSA-O |
| XLogP | 1.78 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |