C16H23N2O3+ — CID 8694817
(4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium (PubChem CID 8694817) has the molecular formula C16H23N2O3+ and a molecular weight of 291.37 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium |
|---|---|
| PubChem CID | 8694817 |
| Molecular Formula | C16H23N2O3+ |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-methyl-[2-oxo-2-(prop-2-ynylamino)ethyl]azanium |
| SMILES | C#CCNC(=O)C[NH+](C)Cc1ccc(OCC)c(OC)c1 |
| InChI | InChI=1S/C16H22N2O3/c1-5-9-17-16(19)12-18(3)11-13-7-8-14(21-6-2)15(10-13)20-4/h1,7-8,10H,6,9,11-12H2,2-4H3,(H,17,19)/p+1 |
| InChIKey | PZJMQZRVJZBRST-UHFFFAOYSA-O |
| XLogP | -0.14 |
| TPSA | 52.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|