C20H26N3O6+ — CID 8798670
(4-ethoxy-3-methoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8798670) has the molecular formula C20H26N3O6+ and a molecular weight of 404.44 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8798670 |
| Molecular Formula | C20H26N3O6+ |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-[2-(2-methoxy-4-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)CC(=O)Nc2ccc([N+](=O)[O-])cc2OC)cc1OC |
| InChI | InChI=1S/C20H25N3O6/c1-5-29-17-9-6-14(10-19(17)28-4)12-22(2)13-20(24)21-16-8-7-15(23(25)26)11-18(16)27-3/h6-11H,5,12-13H2,1-4H3,(H,21,24)/p+1 |
| InChIKey | AAUDNXIFVBQMPL-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|