C21H28N3O6+ — CID 8798541
(4-ethoxy-3-methoxyphenyl)methyl-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium (PubChem CID 8798541) has the molecular formula C21H28N3O6+ and a molecular weight of 418.47 g/mol. Its IUPAC name is (4-ethoxy-3-methoxyphenyl)methyl-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium.
| Compound Name | (4-ethoxy-3-methoxyphenyl)methyl-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8798541 |
| Molecular Formula | C21H28N3O6+ |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | (4-ethoxy-3-methoxyphenyl)methyl-[2-(5-methoxy-2-methyl-4-nitroanilino)-2-oxoethyl]-methylazanium |
| SMILES | CCOc1ccc(C[NH+](C)CC(=O)Nc2cc(OC)c([N+](=O)[O-])cc2C)cc1OC |
| InChI | InChI=1S/C21H27N3O6/c1-6-30-18-8-7-15(10-20(18)29-5)12-23(3)13-21(25)22-16-11-19(28-4)17(24(26)27)9-14(16)2/h7-11H,6,12-13H2,1-5H3,(H,22,25)/p+1 |
| InChIKey | WQXPCZKDQRTTFY-UHFFFAOYSA-O |
| XLogP | 1.97 |
| TPSA | 104.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|