C18H22ClN2O3+ — CID 9248126
[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(2R)-2-hydroxy-2-phenylethyl]-methylazanium (PubChem CID 9248126) has the molecular formula C18H22ClN2O3+ and a molecular weight of 349.84 g/mol. Its IUPAC name is [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(2R)-2-hydroxy-2-phenylethyl]-methylazanium.
| Compound Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(2R)-2-hydroxy-2-phenylethyl]-methylazanium |
|---|---|
| PubChem CID | 9248126 |
| Molecular Formula | C18H22ClN2O3+ |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | [2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-[(2R)-2-hydroxy-2-phenylethyl]-methylazanium |
| SMILES | COc1ccc(Cl)cc1NC(=O)C[NH+](C)C[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H21ClN2O3/c1-21(11-16(22)13-6-4-3-5-7-13)12-18(23)20-15-10-14(19)8-9-17(15)24-2/h3-10,16,22H,11-12H2,1-2H3,(H,20,23)/p+1/t16-/m0/s1 |
| InChIKey | YXROBYAGQMFRSL-INIZCTEOSA-O |
| XLogP | 1.54 |
| TPSA | 63.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |