C18H22BrN2O2+ — CID 9248120
[2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(2S)-2-hydroxy-2-phenylethyl]-methylazanium (PubChem CID 9248120) has the molecular formula C18H22BrN2O2+ and a molecular weight of 378.29 g/mol. Its IUPAC name is [2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(2S)-2-hydroxy-2-phenylethyl]-methylazanium.
| Compound Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(2S)-2-hydroxy-2-phenylethyl]-methylazanium |
|---|---|
| PubChem CID | 9248120 |
| Molecular Formula | C18H22BrN2O2+ |
| Molecular Weight | 378.29 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | [2-(4-bromo-2-methylanilino)-2-oxoethyl]-[(2S)-2-hydroxy-2-phenylethyl]-methylazanium |
| SMILES | Cc1cc(Br)ccc1NC(=O)C[NH+](C)C[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C18H21BrN2O2/c1-13-10-15(19)8-9-16(13)20-18(23)12-21(2)11-17(22)14-6-4-3-5-7-14/h3-10,17,22H,11-12H2,1-2H3,(H,20,23)/p+1/t17-/m1/s1 |
| InChIKey | IUZXAQSWJAXEIT-QGZVFWFLSA-O |
| XLogP | 1.94 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |