C14H21BrN3O2+ — CID 8790467
2-acetamidoethyl-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylazanium (PubChem CID 8790467) has the molecular formula C14H21BrN3O2+ and a molecular weight of 343.25 g/mol. Its IUPAC name is 2-acetamidoethyl-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylazanium.
| Compound Name | 2-acetamidoethyl-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8790467 |
| Molecular Formula | C14H21BrN3O2+ |
| Molecular Weight | 343.25 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-acetamidoethyl-[2-(4-bromo-2-methylanilino)-2-oxoethyl]-methylazanium |
| SMILES | CC(=O)NCC[NH+](C)CC(=O)Nc1ccc(Br)cc1C |
| InChI | InChI=1S/C14H20BrN3O2/c1-10-8-12(15)4-5-13(10)17-14(20)9-18(3)7-6-16-11(2)19/h4-5,8H,6-7,9H2,1-3H3,(H,16,19)(H,17,20)/p+1 |
| InChIKey | FQEAICJFKWKKOG-UHFFFAOYSA-O |
| XLogP | 0.35 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.25 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |