C14H17Cl3N3O2+ — CID 9052711
[2-(cyclopropylamino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium (PubChem CID 9052711) has the molecular formula C14H17Cl3N3O2+ and a molecular weight of 365.67 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9052711 |
| Molecular Formula | C14H17Cl3N3O2+ |
| Molecular Weight | 365.67 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl]-methyl-[2-oxo-2-(2,4,5-trichloroanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1cc(Cl)c(Cl)cc1Cl)CC(=O)NC1CC1 |
| InChI | InChI=1S/C14H16Cl3N3O2/c1-20(6-13(21)18-8-2-3-8)7-14(22)19-12-5-10(16)9(15)4-11(12)17/h4-5,8H,2-3,6-7H2,1H3,(H,18,21)(H,19,22)/p+1 |
| InChIKey | XBYIUNJXWXYDKX-UHFFFAOYSA-O |
| XLogP | 1.38 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.67 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|