C15H19F3N3O4S+ — CID 9197489
[2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9197489) has the molecular formula C15H19F3N3O4S+ and a molecular weight of 394.40 g/mol. Its IUPAC name is [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197489 |
| Molecular Formula | C15H19F3N3O4S+ |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | [2-[[(3R)-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-methyl-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)c(F)c1F)CC(=O)N[C@@H]1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H18F3N3O4S/c1-21(6-12(22)19-9-4-5-26(24,25)8-9)7-13(23)20-11-3-2-10(16)14(17)15(11)18/h2-3,9H,4-8H2,1H3,(H,19,22)(H,20,23)/p+1/t9-/m1/s1 |
| InChIKey | PIKKDGBUVCQZOX-SECBINFHSA-O |
| XLogP | -1.14 |
| TPSA | 96.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|