C15H20F3N2O2+ — CID 9197476
methyl-[[(2R)-oxan-2-yl]methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 9197476) has the molecular formula C15H20F3N2O2+ and a molecular weight of 317.33 g/mol. Its IUPAC name is methyl-[[(2R)-oxan-2-yl]methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | methyl-[[(2R)-oxan-2-yl]methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 9197476 |
| Molecular Formula | C15H20F3N2O2+ |
| Molecular Weight | 317.33 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | methyl-[[(2R)-oxan-2-yl]methyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)c(F)c1F)C[C@H]1CCCCO1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-20(8-10-4-2-3-7-22-10)9-13(21)19-12-6-5-11(16)14(17)15(12)18/h5-6,10H,2-4,7-9H2,1H3,(H,19,21)/p+1/t10-/m1/s1 |
| InChIKey | HTAQKCCOGAELLX-SNVBAGLBSA-O |
| XLogP | 1.13 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.33 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|