C14H17F3N2O2 — CID 95258347
1-ethyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea (PubChem CID 95258347) has the molecular formula C14H17F3N2O2 and a molecular weight of 302.30 g/mol. Its IUPAC name is 1-ethyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea.
| Compound Name | 1-ethyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea |
|---|---|
| PubChem CID | 95258347 |
| Molecular Formula | C14H17F3N2O2 |
| Molecular Weight | 302.30 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-ethyl-1-[[(2S)-oxolan-2-yl]methyl]-3-(2,3,4-trifluorophenyl)urea |
| SMILES | CCN(C[C@@H]1CCCO1)C(=O)Nc1ccc(F)c(F)c1F |
| InChI | InChI=1S/C14H17F3N2O2/c1-2-19(8-9-4-3-7-21-9)14(20)18-11-6-5-10(15)12(16)13(11)17/h5-6,9H,2-4,7-8H2,1H3,(H,18,20)/t9-/m0/s1 |
| InChIKey | WGHDOBJERXSLHJ-VIFPVBQESA-N |
| XLogP | 3.14 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.30 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|