C16H23N3O3S — CID 95310626
2-[2-[[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]sulfanylacetamide (PubChem CID 95310626) has the molecular formula C16H23N3O3S and a molecular weight of 337.45 g/mol. Its IUPAC name is 2-[2-[[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]sulfanylacetamide.
| Compound Name | 2-[2-[[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 95310626 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | 2-[2-[[ethyl-[[(2R)-oxolan-2-yl]methyl]carbamoyl]amino]phenyl]sulfanylacetamide |
| SMILES | CCN(C[C@H]1CCCO1)C(=O)Nc1ccccc1SCC(N)=O |
| InChI | InChI=1S/C16H23N3O3S/c1-2-19(10-12-6-5-9-22-12)16(21)18-13-7-3-4-8-14(13)23-11-15(17)20/h3-4,7-8,12H,2,5-6,9-11H2,1H3,(H2,17,20)(H,18,21)/t12-/m1/s1 |
| InChIKey | AOMFVYMGHZNSTM-GFCCVEGCSA-N |
| XLogP | 2.30 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |