C19H24N2O2S2 — CID 97436139
3-(2-ethylsulfanylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-3-ylmethyl)urea (PubChem CID 97436139) has the molecular formula C19H24N2O2S2 and a molecular weight of 376.55 g/mol. Its IUPAC name is 3-(2-ethylsulfanylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 3-(2-ethylsulfanylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 97436139 |
| Molecular Formula | C19H24N2O2S2 |
| Molecular Weight | 376.55 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | 3-(2-ethylsulfanylphenyl)-1-[[(2S)-oxolan-2-yl]methyl]-1-(thiophen-3-ylmethyl)urea |
| SMILES | CCSc1ccccc1NC(=O)N(Cc1ccsc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C19H24N2O2S2/c1-2-25-18-8-4-3-7-17(18)20-19(22)21(12-15-9-11-24-14-15)13-16-6-5-10-23-16/h3-4,7-9,11,14,16H,2,5-6,10,12-13H2,1H3,(H,20,22)/t16-/m0/s1 |
| InChIKey | PBZPVTZFLKCAIM-INIZCTEOSA-N |
| XLogP | 5.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.55 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |