C18H23N3O2S — CID 126450055
1-[[(2S)-oxolan-2-yl]methyl]-3-(2-pyridin-4-ylethyl)-1-(thiophen-3-ylmethyl)urea (PubChem CID 126450055) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 1-[[(2S)-oxolan-2-yl]methyl]-3-(2-pyridin-4-ylethyl)-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-(2-pyridin-4-ylethyl)-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 126450055 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 1-[[(2S)-oxolan-2-yl]methyl]-3-(2-pyridin-4-ylethyl)-1-(thiophen-3-ylmethyl)urea |
| SMILES | O=C(NCCc1ccncc1)N(Cc1ccsc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H23N3O2S/c22-18(20-9-5-15-3-7-19-8-4-15)21(12-16-6-11-24-14-16)13-17-2-1-10-23-17/h3-4,6-8,11,14,17H,1-2,5,9-10,12-13H2,(H,20,22)/t17-/m0/s1 |
| InChIKey | MLRWODLZNUUFIJ-KRWDZBQOSA-N |
| XLogP | 3.08 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |