C18H19N5O2S — CID 99940406
N-[[(2S)-oxolan-2-yl]methyl]-4-(tetrazol-1-yl)-N-(thiophen-3-ylmethyl)benzamide (PubChem CID 99940406) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is N-[[(2S)-oxolan-2-yl]methyl]-4-(tetrazol-1-yl)-N-(thiophen-3-ylmethyl)benzamide.
| Compound Name | N-[[(2S)-oxolan-2-yl]methyl]-4-(tetrazol-1-yl)-N-(thiophen-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 99940406 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | N-[[(2S)-oxolan-2-yl]methyl]-4-(tetrazol-1-yl)-N-(thiophen-3-ylmethyl)benzamide |
| SMILES | O=C(c1ccc(-n2cnnn2)cc1)N(Cc1ccsc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C18H19N5O2S/c24-18(15-3-5-16(6-4-15)23-13-19-20-21-23)22(10-14-7-9-26-12-14)11-17-2-1-8-25-17/h3-7,9,12-13,17H,1-2,8,10-11H2/t17-/m0/s1 |
| InChIKey | MRZWRWPARCCSIA-KRWDZBQOSA-N |
| XLogP | 2.55 |
| TPSA | 73.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |