C13H18N6O2S — CID 131909854
2-(5-aminotetrazol-1-yl)-N-(oxolan-2-ylmethyl)-N-(thiophen-3-ylmethyl)acetamide (PubChem CID 131909854) has the molecular formula C13H18N6O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2-(5-aminotetrazol-1-yl)-N-(oxolan-2-ylmethyl)-N-(thiophen-3-ylmethyl)acetamide.
| Compound Name | 2-(5-aminotetrazol-1-yl)-N-(oxolan-2-ylmethyl)-N-(thiophen-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 131909854 |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2-(5-aminotetrazol-1-yl)-N-(oxolan-2-ylmethyl)-N-(thiophen-3-ylmethyl)acetamide |
| SMILES | Nc1nnnn1CC(=O)N(Cc1ccsc1)CC1CCCO1 |
| InChI | InChI=1S/C13H18N6O2S/c14-13-15-16-17-19(13)8-12(20)18(6-10-3-5-22-9-10)7-11-2-1-4-21-11/h3,5,9,11H,1-2,4,6-8H2,(H2,14,15,17) |
| InChIKey | HPMGLKBCVOSHIE-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 99.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |