C19H20N4O2S — CID 56912083
N-(oxolan-2-ylmethyl)-1-phenyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide (PubChem CID 56912083) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-1-phenyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide.
| Compound Name | N-(oxolan-2-ylmethyl)-1-phenyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 56912083 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-1-phenyl-N-(thiophen-3-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(c1cn(-c2ccccc2)nn1)N(Cc1ccsc1)CC1CCCO1 |
| InChI | InChI=1S/C19H20N4O2S/c24-19(18-13-23(21-20-18)16-5-2-1-3-6-16)22(11-15-8-10-26-14-15)12-17-7-4-9-25-17/h1-3,5-6,8,10,13-14,17H,4,7,9,11-12H2 |
| InChIKey | OCJOLILELOYWOF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |