C20H22N4O2S — CID 134046136
1-benzyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide (PubChem CID 134046136) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is 1-benzyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide.
| Compound Name | 1-benzyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
|---|---|
| PubChem CID | 134046136 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | 1-benzyl-N-(oxolan-2-ylmethyl)-N-(thiophen-2-ylmethyl)triazole-4-carboxamide |
| SMILES | O=C(c1cn(Cc2ccccc2)nn1)N(Cc1cccs1)CC1CCCO1 |
| InChI | InChI=1S/C20H22N4O2S/c25-20(19-15-24(22-21-19)12-16-6-2-1-3-7-16)23(13-17-8-4-10-26-17)14-18-9-5-11-27-18/h1-3,5-7,9,11,15,17H,4,8,10,12-14H2 |
| InChIKey | CARUJEYIRFNLIK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |