C20H26FN5O2 — CID 119759142
N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide (PubChem CID 119759142) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide |
|---|---|
| PubChem CID | 119759142 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N-(oxolan-2-ylmethyl)-1-piperidin-4-yltriazole-4-carboxamide |
| SMILES | O=C(c1cn(C2CCNCC2)nn1)N(Cc1cccc(F)c1)CC1CCCO1 |
| InChI | InChI=1S/C20H26FN5O2/c21-16-4-1-3-15(11-16)12-25(13-18-5-2-10-28-18)20(27)19-14-26(24-23-19)17-6-8-22-9-7-17/h1,3-4,11,14,17-18,22H,2,5-10,12-13H2 |
| InChIKey | QLNSRHDMQMRENX-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |