C16H22N6O2 — CID 72912485
1-ethyl-1-(oxan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]urea (PubChem CID 72912485) has the molecular formula C16H22N6O2 and a molecular weight of 330.39 g/mol. Its IUPAC name is 1-ethyl-1-(oxan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1-ethyl-1-(oxan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 72912485 |
| Molecular Formula | C16H22N6O2 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | 1-ethyl-1-(oxan-2-ylmethyl)-3-[4-(tetrazol-1-yl)phenyl]urea |
| SMILES | CCN(CC1CCCCO1)C(=O)Nc1ccc(-n2cnnn2)cc1 |
| InChI | InChI=1S/C16H22N6O2/c1-2-21(11-15-5-3-4-10-24-15)16(23)18-13-6-8-14(9-7-13)22-12-17-19-20-22/h6-9,12,15H,2-5,10-11H2,1H3,(H,18,23) |
| InChIKey | OCGVDJWBPJMJJC-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |