C17H22N4O2 — CID 124572395
1-methyl-1-[[(2S)-oxan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)urea (PubChem CID 124572395) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 1-methyl-1-[[(2S)-oxan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)urea.
| Compound Name | 1-methyl-1-[[(2S)-oxan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)urea |
|---|---|
| PubChem CID | 124572395 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 1-methyl-1-[[(2S)-oxan-2-yl]methyl]-3-(4-pyrazol-1-ylphenyl)urea |
| SMILES | CN(C[C@@H]1CCCCO1)C(=O)Nc1ccc(-n2cccn2)cc1 |
| InChI | InChI=1S/C17H22N4O2/c1-20(13-16-5-2-3-12-23-16)17(22)19-14-6-8-15(9-7-14)21-11-4-10-18-21/h4,6-11,16H,2-3,5,12-13H2,1H3,(H,19,22)/t16-/m0/s1 |
| InChIKey | DEIPHCFKXMLEMJ-INIZCTEOSA-N |
| XLogP | 2.91 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |