C14H15F3N3O4+ — CID 8551314
methyl-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium (PubChem CID 8551314) has the molecular formula C14H15F3N3O4+ and a molecular weight of 346.29 g/mol. Its IUPAC name is methyl-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium.
| Compound Name | methyl-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
|---|---|
| PubChem CID | 8551314 |
| Molecular Formula | C14H15F3N3O4+ |
| Molecular Weight | 346.29 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | methyl-[2-oxo-2-(2-oxo-1,3-oxazolidin-3-yl)ethyl]-[2-oxo-2-(2,3,4-trifluoroanilino)ethyl]azanium |
| SMILES | C[NH+](CC(=O)Nc1ccc(F)c(F)c1F)CC(=O)N1CCOC1=O |
| InChI | InChI=1S/C14H14F3N3O4/c1-19(7-11(22)20-4-5-24-14(20)23)6-10(21)18-9-3-2-8(15)12(16)13(9)17/h2-3H,4-7H2,1H3,(H,18,21)/p+1 |
| InChIKey | SFPUHFRWCURZGB-UHFFFAOYSA-O |
| XLogP | -0.46 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.29 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|