C15H17F3N2O4S — CID 113135238
3-(N-acetyl-2,3,4-trifluoroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide (PubChem CID 113135238) has the molecular formula C15H17F3N2O4S and a molecular weight of 378.37 g/mol. Its IUPAC name is 3-(N-acetyl-2,3,4-trifluoroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 3-(N-acetyl-2,3,4-trifluoroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 113135238 |
| Molecular Formula | C15H17F3N2O4S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 3-(N-acetyl-2,3,4-trifluoroanilino)-N-(1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(=O)N(CCC(=O)NC1CCS(=O)(=O)C1)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C15H17F3N2O4S/c1-9(21)20(12-3-2-11(16)14(17)15(12)18)6-4-13(22)19-10-5-7-25(23,24)8-10/h2-3,10H,4-8H2,1H3,(H,19,22) |
| InChIKey | CSORORRYSAWRDO-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|