C17H20ClN3O3S2 — CID 8580233
(2-chloro-7-methylsulfanylquinolin-3-yl)methyl (2R)-2-(carbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 8580233) has the molecular formula C17H20ClN3O3S2 and a molecular weight of 413.95 g/mol. Its IUPAC name is (2-chloro-7-methylsulfanylquinolin-3-yl)methyl (2R)-2-(carbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl (2R)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8580233 |
| Molecular Formula | C17H20ClN3O3S2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | (2-chloro-7-methylsulfanylquinolin-3-yl)methyl (2R)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(N)=O)C(=O)OCc1cc2ccc(SC)cc2nc1Cl |
| InChI | InChI=1S/C17H20ClN3O3S2/c1-25-6-5-13(21-17(19)23)16(22)24-9-11-7-10-3-4-12(26-2)8-14(10)20-15(11)18/h3-4,7-8,13H,5-6,9H2,1-2H3,(H3,19,21,23)/t13-/m1/s1 |
| InChIKey | HKVNGZUCBRXAHG-CYBMUJFWSA-N |
| XLogP | 3.44 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|