C14H20N2O3S — CID 8579686
(4-methylphenyl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate (PubChem CID 8579686) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is (4-methylphenyl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate.
| Compound Name | (4-methylphenyl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 8579686 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (4-methylphenyl)methyl (2S)-2-(carbamoylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)OCc1ccc(C)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-10-3-5-11(6-4-10)9-19-13(17)12(7-8-20-2)16-14(15)18/h3-6,12H,7-9H2,1-2H3,(H3,15,16,18)/t12-/m0/s1 |
| InChIKey | OLIZLVLIVWOYMS-LBPRGKRZSA-N |
| XLogP | 1.83 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |