C21H25NO4S2 — CID 7570446
(4-methylsulfanylphenyl)methyl (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate (PubChem CID 7570446) has the molecular formula C21H25NO4S2 and a molecular weight of 419.57 g/mol. Its IUPAC name is (4-methylsulfanylphenyl)methyl (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate.
| Compound Name | (4-methylsulfanylphenyl)methyl (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate |
|---|---|
| PubChem CID | 7570446 |
| Molecular Formula | C21H25NO4S2 |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | (4-methylsulfanylphenyl)methyl (2R)-4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate |
| SMILES | CSCC[C@@H](NC(=O)COc1ccccc1)C(=O)OCc1ccc(SC)cc1 |
| InChI | InChI=1S/C21H25NO4S2/c1-27-13-12-19(22-20(23)15-25-17-6-4-3-5-7-17)21(24)26-14-16-8-10-18(28-2)11-9-16/h3-11,19H,12-15H2,1-2H3,(H,22,23)/t19-/m1/s1 |
| InChIKey | UXPOMUUKZKLUNV-LJQANCHMSA-N |
| XLogP | 3.77 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |