C20H21BrFNO4S — CID 16599824
(2-bromo-4-fluorophenyl)methyl 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate (PubChem CID 16599824) has the molecular formula C20H21BrFNO4S and a molecular weight of 470.36 g/mol. Its IUPAC name is (2-bromo-4-fluorophenyl)methyl 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate.
| Compound Name | (2-bromo-4-fluorophenyl)methyl 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate |
|---|---|
| PubChem CID | 16599824 |
| Molecular Formula | C20H21BrFNO4S |
| Molecular Weight | 470.36 g/mol |
| Exact Mass | 469.04 |
| IUPAC Name | (2-bromo-4-fluorophenyl)methyl 4-methylsulfanyl-2-[(2-phenoxyacetyl)amino]butanoate |
| SMILES | CSCCC(NC(=O)COc1ccccc1)C(=O)OCc1ccc(F)cc1Br |
| InChI | InChI=1S/C20H21BrFNO4S/c1-28-10-9-18(23-19(24)13-26-16-5-3-2-4-6-16)20(25)27-12-14-7-8-15(22)11-17(14)21/h2-8,11,18H,9-10,12-13H2,1H3,(H,23,24) |
| InChIKey | WXSKKWPIAACNAI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |