C17H25NO3S2 — CID 3855823
propan-2-yl 4-methylsulfanyl-2-[[2-(4-methylsulfanylphenyl)acetyl]amino]butanoate (PubChem CID 3855823) has the molecular formula C17H25NO3S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is propan-2-yl 4-methylsulfanyl-2-[[2-(4-methylsulfanylphenyl)acetyl]amino]butanoate.
| Compound Name | propan-2-yl 4-methylsulfanyl-2-[[2-(4-methylsulfanylphenyl)acetyl]amino]butanoate |
|---|---|
| PubChem CID | 3855823 |
| Molecular Formula | C17H25NO3S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | propan-2-yl 4-methylsulfanyl-2-[[2-(4-methylsulfanylphenyl)acetyl]amino]butanoate |
| SMILES | CSCCC(NC(=O)Cc1ccc(SC)cc1)C(=O)OC(C)C |
| InChI | InChI=1S/C17H25NO3S2/c1-12(2)21-17(20)15(9-10-22-3)18-16(19)11-13-5-7-14(23-4)8-6-13/h5-8,12,15H,9-11H2,1-4H3,(H,18,19) |
| InChIKey | IMUHWPIQOFRRCQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |