C14H20N2O3S — CID 82545994
methyl 2-[[2-(4-aminophenyl)acetyl]amino]-4-methylsulfanylbutanoate (PubChem CID 82545994) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is methyl 2-[[2-(4-aminophenyl)acetyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl 2-[[2-(4-aminophenyl)acetyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 82545994 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | methyl 2-[[2-(4-aminophenyl)acetyl]amino]-4-methylsulfanylbutanoate |
| SMILES | COC(=O)C(CCSC)NC(=O)Cc1ccc(N)cc1 |
| InChI | InChI=1S/C14H20N2O3S/c1-19-14(18)12(7-8-20-2)16-13(17)9-10-3-5-11(15)6-4-10/h3-6,12H,7-9,15H2,1-2H3,(H,16,17) |
| InChIKey | MBXAWBUFQAGTJT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|