C14H19ClN2O5 — CID 119768777
dimethyl 2-[[2-(4-aminophenyl)acetyl]amino]butanedioate;hydrochloride (PubChem CID 119768777) has the molecular formula C14H19ClN2O5 and a molecular weight of 330.77 g/mol. Its IUPAC name is dimethyl 2-[[2-(4-aminophenyl)acetyl]amino]butanedioate;hydrochloride.
| Compound Name | dimethyl 2-[[2-(4-aminophenyl)acetyl]amino]butanedioate;hydrochloride |
|---|---|
| PubChem CID | 119768777 |
| Molecular Formula | C14H19ClN2O5 |
| Molecular Weight | 330.77 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | dimethyl 2-[[2-(4-aminophenyl)acetyl]amino]butanedioate;hydrochloride |
| SMILES | COC(=O)CC(NC(=O)Cc1ccc(N)cc1)C(=O)OC.Cl |
| InChI | InChI=1S/C14H18N2O5.ClH/c1-20-13(18)8-11(14(19)21-2)16-12(17)7-9-3-5-10(15)6-4-9;/h3-6,11H,7-8,15H2,1-2H3,(H,16,17);1H |
| InChIKey | UDUZCSLGGBSGOK-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.77 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|