C16H23NO4S2 — CID 9428591
methyl (2R)-2-[[2-(4-ethoxyphenyl)sulfanylacetyl]amino]-4-methylsulfanylbutanoate (PubChem CID 9428591) has the molecular formula C16H23NO4S2 and a molecular weight of 357.50 g/mol. Its IUPAC name is methyl (2R)-2-[[2-(4-ethoxyphenyl)sulfanylacetyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | methyl (2R)-2-[[2-(4-ethoxyphenyl)sulfanylacetyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 9428591 |
| Molecular Formula | C16H23NO4S2 |
| Molecular Weight | 357.50 g/mol |
| Exact Mass | 357.11 |
| IUPAC Name | methyl (2R)-2-[[2-(4-ethoxyphenyl)sulfanylacetyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCOc1ccc(SCC(=O)N[C@H](CCSC)C(=O)OC)cc1 |
| InChI | InChI=1S/C16H23NO4S2/c1-4-21-12-5-7-13(8-6-12)23-11-15(18)17-14(9-10-22-3)16(19)20-2/h5-8,14H,4,9-11H2,1-3H3,(H,17,18)/t14-/m1/s1 |
| InChIKey | KWIISKSLSIIQOR-CQSZACIVSA-N |
| XLogP | 2.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.50 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |