C13H19NO4S — CID 79675642
2-(4-ethoxyphenyl)sulfanyl-N-(2-methoxyethoxy)acetamide (PubChem CID 79675642) has the molecular formula C13H19NO4S and a molecular weight of 285.37 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)sulfanyl-N-(2-methoxyethoxy)acetamide.
| Compound Name | 2-(4-ethoxyphenyl)sulfanyl-N-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 79675642 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 2-(4-ethoxyphenyl)sulfanyl-N-(2-methoxyethoxy)acetamide |
| SMILES | CCOc1ccc(SCC(=O)NOCCOC)cc1 |
| InChI | InChI=1S/C13H19NO4S/c1-3-17-11-4-6-12(7-5-11)19-10-13(15)14-18-9-8-16-2/h4-7H,3,8-10H2,1-2H3,(H,14,15) |
| InChIKey | AEQPYGBISZQNJI-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|