C13H18N2O3S — CID 57193060
(4-aminophenyl) (2S)-2-[(2-deuterioacetyl)amino]-4-methylsulfanylbutanoate (PubChem CID 57193060) has the molecular formula C13H18N2O3S and a molecular weight of 283.37 g/mol. Its IUPAC name is (4-aminophenyl) (2S)-2-[(2-deuterioacetyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (4-aminophenyl) (2S)-2-[(2-deuterioacetyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 57193060 |
| Molecular Formula | C13H18N2O3S |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | (4-aminophenyl) (2S)-2-[(2-deuterioacetyl)amino]-4-methylsulfanylbutanoate |
| SMILES | [2H]CC(=O)N[C@@H](CCSC)C(=O)Oc1ccc(N)cc1 |
| InChI | InChI=1S/C13H18N2O3S/c1-9(16)15-12(7-8-19-2)13(17)18-11-5-3-10(14)4-6-11/h3-6,12H,7-8,14H2,1-2H3,(H,15,16)/t12-/m0/s1/i1D |
| InChIKey | OXWMWGBZVUCAFN-JJSKNPOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|