C22H28N2O2S2 — CID 3820685
propan-2-yl 2-(benzhydrylcarbamothioylamino)-4-methylsulfanylbutanoate (PubChem CID 3820685) has the molecular formula C22H28N2O2S2 and a molecular weight of 416.61 g/mol. Its IUPAC name is propan-2-yl 2-(benzhydrylcarbamothioylamino)-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl 2-(benzhydrylcarbamothioylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 3820685 |
| Molecular Formula | C22H28N2O2S2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | propan-2-yl 2-(benzhydrylcarbamothioylamino)-4-methylsulfanylbutanoate |
| SMILES | CSCCC(NC(=S)NC(c1ccccc1)c1ccccc1)C(=O)OC(C)C |
| InChI | InChI=1S/C22H28N2O2S2/c1-16(2)26-21(25)19(14-15-28-3)23-22(27)24-20(17-10-6-4-7-11-17)18-12-8-5-9-13-18/h4-13,16,19-20H,14-15H2,1-3H3,(H2,23,24,27) |
| InChIKey | WRGWORCWNFUEKO-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|