C15H19N3O7S — CID 91979303
propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 91979303) has the molecular formula C15H19N3O7S and a molecular weight of 385.40 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91979303 |
| Molecular Formula | C15H19N3O7S |
| Molecular Weight | 385.40 g/mol |
| Exact Mass | 385.09 |
| IUPAC Name | propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)C(=O)OC(C)C |
| InChI | InChI=1S/C15H19N3O7S/c1-9(2)25-15(20)13(4-5-26-3)16-14(19)10-6-11(17(21)22)8-12(7-10)18(23)24/h6-9,13H,4-5H2,1-3H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | XQPIXZSFYYJZFL-CYBMUJFWSA-N |
| XLogP | 2.31 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|