C15H19F3N2O3S — CID 3859913
propan-2-yl 4-methylsulfanyl-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoate (PubChem CID 3859913) has the molecular formula C15H19F3N2O3S and a molecular weight of 364.39 g/mol. Its IUPAC name is propan-2-yl 4-methylsulfanyl-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoate.
| Compound Name | propan-2-yl 4-methylsulfanyl-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoate |
|---|---|
| PubChem CID | 3859913 |
| Molecular Formula | C15H19F3N2O3S |
| Molecular Weight | 364.39 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | propan-2-yl 4-methylsulfanyl-2-[[6-(trifluoromethyl)pyridine-3-carbonyl]amino]butanoate |
| SMILES | CSCCC(NC(=O)c1ccc(C(F)(F)F)nc1)C(=O)OC(C)C |
| InChI | InChI=1S/C15H19F3N2O3S/c1-9(2)23-14(22)11(6-7-24-3)20-13(21)10-4-5-12(19-8-10)15(16,17)18/h4-5,8-9,11H,6-7H2,1-3H3,(H,20,21) |
| InChIKey | JXAJXULZSCSVQT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |