C12H13N2O5S- — CID 7063439
(2R)-4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 7063439) has the molecular formula C12H13N2O5S- and a molecular weight of 297.31 g/mol. Its IUPAC name is (2R)-4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | (2R)-4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 7063439 |
| Molecular Formula | C12H13N2O5S- |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | (2R)-4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CSCC[C@@H](NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)[O-] |
| InChI | InChI=1S/C12H14N2O5S/c1-20-6-5-10(12(16)17)13-11(15)8-3-2-4-9(7-8)14(18)19/h2-4,7,10H,5-6H2,1H3,(H,13,15)(H,16,17)/p-1/t10-/m1/s1 |
| InChIKey | QXXOOFQUSPEKGT-SNVBAGLBSA-M |
| XLogP | 0.20 |
| TPSA | 112.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|