C16H20F3N3O4S — CID 56549091
N-[4-methylsulfanyl-1-[methyl(3,3,3-trifluoropropyl)amino]-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 56549091) has the molecular formula C16H20F3N3O4S and a molecular weight of 407.41 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-[methyl(3,3,3-trifluoropropyl)amino]-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[4-methylsulfanyl-1-[methyl(3,3,3-trifluoropropyl)amino]-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 56549091 |
| Molecular Formula | C16H20F3N3O4S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | N-[4-methylsulfanyl-1-[methyl(3,3,3-trifluoropropyl)amino]-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N(C)CCC(F)(F)F |
| InChI | InChI=1S/C16H20F3N3O4S/c1-21(8-7-16(17,18)19)15(24)13(6-9-27-2)20-14(23)11-4-3-5-12(10-11)22(25)26/h3-5,10,13H,6-9H2,1-2H3,(H,20,23) |
| InChIKey | LXARUNMGRFFGEJ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|