C17H25ClN4O4S — CID 119373277
N-[1-(4-aminopiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 119373277) has the molecular formula C17H25ClN4O4S and a molecular weight of 416.93 g/mol. Its IUPAC name is N-[1-(4-aminopiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[1-(4-aminopiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119373277 |
| Molecular Formula | C17H25ClN4O4S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-[1-(4-aminopiperidin-1-yl)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)N1CCC(N)CC1.Cl |
| InChI | InChI=1S/C17H24N4O4S.ClH/c1-26-10-7-15(17(23)20-8-5-13(18)6-9-20)19-16(22)12-3-2-4-14(11-12)21(24)25;/h2-4,11,13,15H,5-10,18H2,1H3,(H,19,22);1H |
| InChIKey | OLTRRUFMZUXZFV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 118.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|