C18H27ClN4O4S — CID 119460361
N-[4-methylsulfanyl-1-oxo-1-(piperidin-3-ylmethylamino)butan-2-yl]-3-nitrobenzamide;hydrochloride (PubChem CID 119460361) has the molecular formula C18H27ClN4O4S and a molecular weight of 430.96 g/mol. Its IUPAC name is N-[4-methylsulfanyl-1-oxo-1-(piperidin-3-ylmethylamino)butan-2-yl]-3-nitrobenzamide;hydrochloride.
| Compound Name | N-[4-methylsulfanyl-1-oxo-1-(piperidin-3-ylmethylamino)butan-2-yl]-3-nitrobenzamide;hydrochloride |
|---|---|
| PubChem CID | 119460361 |
| Molecular Formula | C18H27ClN4O4S |
| Molecular Weight | 430.96 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[4-methylsulfanyl-1-oxo-1-(piperidin-3-ylmethylamino)butan-2-yl]-3-nitrobenzamide;hydrochloride |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)NCC1CCCNC1.Cl |
| InChI | InChI=1S/C18H26N4O4S.ClH/c1-27-9-7-16(18(24)20-12-13-4-3-8-19-11-13)21-17(23)14-5-2-6-15(10-14)22(25)26;/h2,5-6,10,13,16,19H,3-4,7-9,11-12H2,1H3,(H,20,24)(H,21,23);1H |
| InChIKey | GFXUVJVBLODVEC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.96 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|