C22H33N5O5S — CID 55447119
N-[1-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 55447119) has the molecular formula C22H33N5O5S and a molecular weight of 479.60 g/mol. Its IUPAC name is N-[1-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[1-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 55447119 |
| Molecular Formula | C22H33N5O5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | N-[1-[4-[2-(diethylamino)-2-oxoethyl]piperazin-1-yl]-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CCN(CC)C(=O)CN1CCN(C(=O)C(CCSC)NC(=O)c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C22H33N5O5S/c1-4-25(5-2)20(28)16-24-10-12-26(13-11-24)22(30)19(9-14-33-3)23-21(29)17-7-6-8-18(15-17)27(31)32/h6-8,15,19H,4-5,9-14,16H2,1-3H3,(H,23,29) |
| InChIKey | AJVZKMADRQYSFX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|