C20H23N3O5S — CID 8745440
N-[(2S)-1-(4-ethoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide (PubChem CID 8745440) has the molecular formula C20H23N3O5S and a molecular weight of 417.49 g/mol. Its IUPAC name is N-[(2S)-1-(4-ethoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide.
| Compound Name | N-[(2S)-1-(4-ethoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 8745440 |
| Molecular Formula | C20H23N3O5S |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | N-[(2S)-1-(4-ethoxyanilino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(NC(=O)[C@H](CCSC)NC(=O)c2cccc([N+](=O)[O-])c2)cc1 |
| InChI | InChI=1S/C20H23N3O5S/c1-3-28-17-9-7-15(8-10-17)21-20(25)18(11-12-29-2)22-19(24)14-5-4-6-16(13-14)23(26)27/h4-10,13,18H,3,11-12H2,1-2H3,(H,21,25)(H,22,24)/t18-/m0/s1 |
| InChIKey | XAHYTJDUAGBKFE-SFHVURJKSA-N |
| XLogP | 3.48 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|