C18H24N4O7S — CID 55324009
[2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate (PubChem CID 55324009) has the molecular formula C18H24N4O7S and a molecular weight of 440.48 g/mol. Its IUPAC name is [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate.
| Compound Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 55324009 |
| Molecular Formula | C18H24N4O7S |
| Molecular Weight | 440.48 g/mol |
| Exact Mass | 440.14 |
| IUPAC Name | [2-oxo-2-(propan-2-ylcarbamoylamino)ethyl] 4-methylsulfanyl-2-[(3-nitrobenzoyl)amino]butanoate |
| SMILES | CSCCC(NC(=O)c1cccc([N+](=O)[O-])c1)C(=O)OCC(=O)NC(=O)NC(C)C |
| InChI | InChI=1S/C18H24N4O7S/c1-11(2)19-18(26)21-15(23)10-29-17(25)14(7-8-30-3)20-16(24)12-5-4-6-13(9-12)22(27)28/h4-6,9,11,14H,7-8,10H2,1-3H3,(H,20,24)(H2,19,21,23,26) |
| InChIKey | LQZSJUWYFQBVCZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.48 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|