C19H18FN3O7 — CID 100984531
propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-(4-fluorophenyl)propanoate (PubChem CID 100984531) has the molecular formula C19H18FN3O7 and a molecular weight of 419.37 g/mol. Its IUPAC name is propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-(4-fluorophenyl)propanoate.
| Compound Name | propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-(4-fluorophenyl)propanoate |
|---|---|
| PubChem CID | 100984531 |
| Molecular Formula | C19H18FN3O7 |
| Molecular Weight | 419.37 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | propan-2-yl (2R)-2-[(3,5-dinitrobenzoyl)amino]-3-(4-fluorophenyl)propanoate |
| SMILES | CC(C)OC(=O)[C@@H](Cc1ccc(F)cc1)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18FN3O7/c1-11(2)30-19(25)17(7-12-3-5-14(20)6-4-12)21-18(24)13-8-15(22(26)27)10-16(9-13)23(28)29/h3-6,8-11,17H,7H2,1-2H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | WLEJLVIRXZUJNC-QGZVFWFLSA-N |
| XLogP | 2.93 |
| TPSA | 141.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.37 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|