C25H24ClNO3S — CID 2123657
[(S)-(4-chlorophenyl)-phenylmethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 2123657) has the molecular formula C25H24ClNO3S and a molecular weight of 453.99 g/mol. Its IUPAC name is [(S)-(4-chlorophenyl)-phenylmethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [(S)-(4-chlorophenyl)-phenylmethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2123657 |
| Molecular Formula | C25H24ClNO3S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [(S)-(4-chlorophenyl)-phenylmethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)O[C@@H](c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H24ClNO3S/c1-31-17-16-22(27-24(28)20-10-6-3-7-11-20)25(29)30-23(18-8-4-2-5-9-18)19-12-14-21(26)15-13-19/h2-15,22-23H,16-17H2,1H3,(H,27,28)/t22-,23+/m1/s1 |
| InChIKey | FJTRDVBUNIASBG-PKTZIBPZSA-N |
| XLogP | 5.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |