C14H17ClN2O4S — CID 7939780
(2-amino-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 7939780) has the molecular formula C14H17ClN2O4S and a molecular weight of 344.82 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (2-amino-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7939780 |
| Molecular Formula | C14H17ClN2O4S |
| Molecular Weight | 344.82 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | (2-amino-2-oxoethyl) (2R)-2-[(4-chlorobenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccc(Cl)cc1)C(=O)OCC(N)=O |
| InChI | InChI=1S/C14H17ClN2O4S/c1-22-7-6-11(14(20)21-8-12(16)18)17-13(19)9-2-4-10(15)5-3-9/h2-5,11H,6-8H2,1H3,(H2,16,18)(H,17,19)/t11-/m1/s1 |
| InChIKey | QWFWSPURKHGFOE-LLVKDONJSA-N |
| XLogP | 1.22 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.82 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |