C18H26N2O4S — CID 7982738
(2-amino-2-oxoethyl) (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 7982738) has the molecular formula C18H26N2O4S and a molecular weight of 366.48 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | (2-amino-2-oxoethyl) (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7982738 |
| Molecular Formula | C18H26N2O4S |
| Molecular Weight | 366.48 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | (2-amino-2-oxoethyl) (2S)-2-[(4-tert-butylbenzoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@H](NC(=O)c1ccc(C(C)(C)C)cc1)C(=O)OCC(N)=O |
| InChI | InChI=1S/C18H26N2O4S/c1-18(2,3)13-7-5-12(6-8-13)16(22)20-14(9-10-25-4)17(23)24-11-15(19)21/h5-8,14H,9-11H2,1-4H3,(H2,19,21)(H,20,22)/t14-/m0/s1 |
| InChIKey | DUOGLOJBIIRSCD-AWEZNQCLSA-N |
| XLogP | 1.86 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.48 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |