C19H19ClFNO3S — CID 7191215
(2-chloro-6-fluorophenyl)methyl (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 7191215) has the molecular formula C19H19ClFNO3S and a molecular weight of 395.88 g/mol. Its IUPAC name is (2-chloro-6-fluorophenyl)methyl (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | (2-chloro-6-fluorophenyl)methyl (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 7191215 |
| Molecular Formula | C19H19ClFNO3S |
| Molecular Weight | 395.88 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (2-chloro-6-fluorophenyl)methyl (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C19H19ClFNO3S/c1-26-11-10-17(22-18(23)13-6-3-2-4-7-13)19(24)25-12-14-15(20)8-5-9-16(14)21/h2-9,17H,10-12H2,1H3,(H,22,23)/t17-/m1/s1 |
| InChIKey | VNJHZUMUEWMQKB-QGZVFWFLSA-N |
| XLogP | 4.07 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.88 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |