C20H19Cl3N2O4S — CID 2097452
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate (PubChem CID 2097452) has the molecular formula C20H19Cl3N2O4S and a molecular weight of 489.81 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 2097452 |
| Molecular Formula | C20H19Cl3N2O4S |
| Molecular Weight | 489.81 g/mol |
| Exact Mass | 488.01 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] (2R)-2-benzamido-4-methylsulfanylbutanoate |
| SMILES | CSCC[C@@H](NC(=O)c1ccccc1)C(=O)OCC(=O)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C20H19Cl3N2O4S/c1-30-8-7-16(25-19(27)12-5-3-2-4-6-12)20(28)29-11-18(26)24-17-10-14(22)13(21)9-15(17)23/h2-6,9-10,16H,7-8,11H2,1H3,(H,24,26)(H,25,27)/t16-/m1/s1 |
| InChIKey | SQCHFBJCZBXPAJ-MRXNPFEDSA-N |
| XLogP | 4.68 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.81 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|